CAS 3529-82-6
:3-Nitrophenyl isothiocyanate
Description:
3-Nitrophenyl isothiocyanate is an organic compound characterized by the presence of both a nitro group and an isothiocyanate functional group attached to a phenyl ring. Its molecular structure consists of a phenyl ring substituted at the meta position with a nitro group and at the para position with an isothiocyanate group. This compound is typically a yellow crystalline solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the isothiocyanate group. It is often used in organic synthesis and as a reagent in various chemical reactions, including the preparation of thioureas and other derivatives. Additionally, 3-nitrophenyl isothiocyanate has applications in biological studies, particularly in the field of medicinal chemistry, where it may serve as a potential lead compound for the development of pharmaceuticals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.
Formula:C7H4N2O2S
InChI:InChI=1S/C7H4N2O2S/c10-9(11)7-3-1-2-6(4-7)8-5-12/h1-4H
InChI key:InChIKey=OEZXLKSZOAWNJU-UHFFFAOYSA-N
SMILES:N(=C=S)C1=CC(N(=O)=O)=CC=C1
Synonyms:- 1-Isothiocyanato-3-Nitrobenzene
- 3-Isothiocyanatonitrobenzene
- Benzene, 1-isothiocyanato-3-nitro-
- Isothiocyanic acid, m-nitrophenyl ester
- m-Nitrophenyl isothiocyanate
- 3-Nitrophenyl isothiocyanate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Nitrophenyl isothiocyanate
CAS:Formula:C7H4N2O2SPurity:98%Color and Shape:SolidMolecular weight:180.18393-Nitrophenyl isothiocyanate
CAS:3-Nitrophenyl isothiocyanatePurity:98%Molecular weight:180.18386g/mol1-Isothiocyanato-3-nitrobenzene
CAS:Formula:C7H4N2O2SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalineMolecular weight:180.183-Nitrophenyl isothiocyanate
CAS:Formula:C7H4N2O2SPurity:98%Color and Shape:SolidMolecular weight:180.183-Nitrophenyl isothiocyanate
CAS:3-Nitrophenyl isothiocyanate (3NPITC) is a trifluoroacetic acid derivative that can be used as an anticancer agent. 3NPITC is synthesized in a solid-phase synthesis process, which involves the use of amines and provides a high detection sensitivity. 3NPITC inhibits the proliferation of glioma cells by inhibiting the growth of cells that are in the G1/S phase of the cell cycle. It also has cytostatic effects on other cancer cells, such as leukemia and lymphoma, due to its ability to inhibit DNA synthesis. 3NPITC does not exhibit chemical instability and has been shown to have an isolated yield of 83%.
Formula:O2NC6H4NCSPurity:Min. 95%Molecular weight:180.18 g/mol




