CAS 353-97-9
:1,1,2-tribromo-1,2-difluoroethane
Description:
1,1,2-Tribromo-1,2-difluoroethane, with the CAS number 353-97-9, is a halogenated organic compound that belongs to the class of bromofluorinated hydrocarbons. It is characterized by the presence of three bromine atoms and two fluorine atoms attached to a two-carbon ethane backbone. This compound is typically a colorless liquid at room temperature and is known for its relatively high density and low volatility. It is non-flammable and has a low solubility in water, making it more soluble in organic solvents. The presence of multiple halogen atoms contributes to its chemical stability and potential use as a refrigerant or in other industrial applications. However, due to environmental concerns, particularly regarding ozone depletion and greenhouse gas effects, the use of such halogenated compounds is often regulated. Safety precautions are necessary when handling this substance, as it may pose health risks through inhalation or skin contact.
Formula:C2HBr3F2
InChI:InChI=1/C2HBr3F2/c3-1(6)2(4,5)7/h1H
SMILES:C(C(Br)(Br)F)(Br)F
Synonyms:- Ethane, 1,1,2-Tribromo-1,2-Difluoro-
- 1,1,2-Tribromo-1,2-difluoroethane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,1,2-Tribromo-1,2-Difluoroethane
CAS:Controlled Product<p>1,1,2-Tribromo-1,2-Difluoroethane is a gaseous chemical that is soluble in salt solution. It can be solubilized in organic solvents such as ethers, chloroform, and carbon tetrachloride. The compound hydrolyzes at high temperatures and thermally decomposes at temperatures above 100°C. It also reacts with water to release hydrogen bromide and hydrogen fluoride gas. This chemical has been shown to inhibit the growth of many bacteria by inhibiting protein synthesis. 1,1,2-Tribromo-1,2-Difluoroethane is used as an industrial solvent and can be injected into the body or introduced into the body by other methods such as inhalation or ingestion. 1,1,2-Tribromo-1,2-Difluoroethane is hydrophobic and has a molecular weight of about 186 grams</p>Formula:C2HBr3F2Purity:Min. 95%Molecular weight:302.74 g/mol
