CAS 3530-14-1

2-hydroxyacetohydrazide

Description:

2-Hydroxyacetohydrazide, with the CAS number 3530-14-1, is an organic compound characterized by the presence of both a hydrazide and a hydroxyl functional group. It typically appears as a white to off-white crystalline solid. This compound is known for its potential applications in medicinal chemistry, particularly as a precursor in the synthesis of various pharmaceuticals and agrochemicals. Its structure features a hydrazine moiety, which contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and substitution reactions. The hydroxyl group enhances its solubility in polar solvents, making it useful in various formulations. Additionally, 2-hydroxyacetohydrazide may exhibit biological activity, including antimicrobial and anti-inflammatory properties, although specific biological effects can vary based on the context of its use. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential toxicity and reactivity. Proper safety protocols should be followed when working with this compound in laboratory settings.

Formula: C₂H₆N₂O₂

InChI: InChI=1/C2H6N2O2/c3-4-2(6)1-5/h5H,1,3H2,(H,4,6)

SMILES: C(C(=NN)O)O

2-Hydroxyacetohydrazide

CAS: 3530-14-1

Formula: C₂H₆N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 90.0812

Ref: IN-DA007DQ3

Hydroxyacetylhydrazine

CAS: 3530-14-1

Hydroxyacetylhydrazine

Purity: 98%

Molecular weight: 90.082g/mol

Ref: 54-OR1013544

2-Hydroxyacetohydrazide

CAS: 3530-14-1

Formula: C₂H₆N₂O₂

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 90.082

Ref: 10-F069267

Hydroxyacetic Acid Hydrazide

Controlled Product

CAS: 3530-14-1

Applications Hydroxyacetic Acid Hydrazide (cas# 3530-14-1) is a compound useful in organic synthesis.

Formula: C₂H₆N₂O₂

Color and Shape: Neat

Molecular weight: 90.08

Ref: TR-H715400