CAS 35302-72-8
:2-(trichloroacetyl)pyrrole
Description:
2-(Trichloroacetyl)pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of the trichloroacetyl group introduces significant reactivity due to the electron-withdrawing nature of the trichloroacetyl moiety, which can influence the compound's chemical behavior and stability. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The trichloroacetyl group can participate in nucleophilic substitution reactions, making it a useful building block in synthetic chemistry. Additionally, due to the presence of chlorine atoms, it may exhibit specific environmental and health considerations, necessitating careful handling and storage. Overall, 2-(trichloroacetyl)pyrrole is a versatile compound with notable chemical properties that make it valuable in various chemical applications.
Formula:C6H4Cl3NO
InChI:InChI=1/C6H4Cl3NO/c7-6(8,9)5(11)4-2-1-3-10-4/h1-3,10H
SMILES:c1cc(C(=O)C(Cl)(Cl)Cl)[nH]c1
Synonyms:- 2-Trichloroacetylpyrrole
- 2,2,2-trichloro-1-(1H-pyrrol-2-yl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Trichloroacetyl)pyrrole
CAS:Formula:C6H4Cl3NOPurity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:212.452-(Trichloroacetyl)pyrrole, 99+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H4Cl3NOPurity:99+%Color and Shape:Yellow to gray to brown, Powder or chunksMolecular weight:212.45Ethanone, 2,2,2-trichloro-1-(1H-pyrrol-2-yl)-
CAS:Formula:C6H4Cl3NOPurity:98%Color and Shape:SolidMolecular weight:212.46112-(Trichloroacetyl)-1H-pyrrole
CAS:2-(Trichloroacetyl)-1H-pyrroleFormula:C6H4Cl3NOPurity:≥95%Color and Shape: grey solidMolecular weight:212.46g/mol2-(Trichloroacetyl)pyrrole
CAS:Formula:C6H4Cl3NOPurity:97%Color and Shape:Grey powderMolecular weight:212.452-(Trichloroacetyl)pyrrole
CAS:Controlled ProductApplications 2-(Trichloroacetyl)pyrrole, is a building block used for the synthesis of more complex pharmaceutical compounds, such as Oroidin, Hymenidin and Clathrodin.
References Rasapalli, S., et al.: Org. Biomol. Chem., 11, 4133 (2013);Formula:C6H4Cl3NOColor and Shape:NeatMolecular weight:212.46





