
CAS 35303-08-3
:Kinamycin C
Description:
Kinamycin C is a naturally occurring antibiotic belonging to the class of compounds known as anthracyclines, which are characterized by their complex polycyclic structures. It is produced by certain strains of the bacterium *Streptomyces* and exhibits notable antibacterial and antitumor properties. The chemical structure of Kinamycin C features a fused ring system that contributes to its biological activity, particularly its ability to intercalate DNA, thereby disrupting cellular processes. This compound is known for its potential in cancer therapy, as it can inhibit the growth of various cancer cell lines. Kinamycin C is also recognized for its unique mechanism of action, which involves the generation of reactive oxygen species that can lead to oxidative stress in target cells. Due to its potent biological effects, Kinamycin C has been the subject of research aimed at understanding its pharmacological properties and potential therapeutic applications. However, like many antibiotics, its use may be limited by issues of resistance and toxicity, necessitating further studies to optimize its clinical utility.
Formula:C24H20N2O10
InChI:InChI=1S/C24H20N2O10/c1-8(27)34-21-15-14-16(20(32)13-11(19(14)31)6-5-7-12(13)30)18(26-25)17(15)22(35-9(2)28)24(4,33)23(21)36-10(3)29/h5-7,21-23,30,33H,1-4H3/t21-,22+,23+,24+/m0/s1
InChI key:InChIKey=MXDLFLPONIABIS-OLKYXYMISA-N
SMILES:O(C(C)=O)[C@H]1C2=C(C(=[N+]=[N-])C3=C2C(=O)C=4C(C3=O)=C(O)C=CC4)[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]1OC(C)=O
Synonyms:- 1H-Benzo[b]fluorene-5,10-dione, 1,3,4-tris(acetyloxy)-11-diazo-2,3,4,11-tetrahydro-2,9-dihydroxy-2-methyl-, [1R-(1α,2α,3β,4α)]-
- 1H-Benzo[b]fluorene-5,10-dione, 1,3,4-tris(acetyloxy)-11-diazo-2,3,4,11-tetrahydro-2,9-dihydroxy-2-methyl-, (1R,2R,3R,4S)-
- (1R,2R,3R,4S)-1,3,4-Tris(acetyloxy)-11-diazo-2,3,4,11-tetrahydro-2,9-dihydroxy-2-methyl-1H-benzo[b]fluorene-5,10-dione
- NSC 138425
- Kinamycin C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Kinamycin C
CAS:Kinamycin C is a bacterial metabolite used as an anticancer agent.Formula:C24H20N2O10Color and Shape:SolidMolecular weight:496.428
