CAS 35306-33-3
:Gelsemine, monohydrochloride
Description:
Gelsemine, monohydrochloride is a chemical compound derived from the plant Gelsemium sempervirens, commonly known as yellow jasmine. It is classified as an alkaloid and is known for its potent pharmacological properties. The monohydrochloride form indicates that the compound is a hydrochloride salt, which typically enhances its solubility in water, making it more bioavailable for medicinal applications. Gelsemine exhibits a range of biological activities, including analgesic, anti-inflammatory, and muscle relaxant effects, and has been studied for its potential use in treating various conditions, including pain and anxiety. However, it is also associated with toxicity, and its use must be approached with caution due to the risk of severe side effects, including respiratory depression and cardiovascular complications. The compound's structure includes a complex bicyclic framework, contributing to its unique chemical behavior. As with many alkaloids, gelsemine's effects are dose-dependent, and research continues to explore its therapeutic potential and safety profile.
Formula:C20H23ClN2O2
InChI:InChI=1/C20H22N2O2.ClH/c1-3-19-10-22(2)16-11-9-24-15(8-13(11)19)20(17(16)19)12-6-4-5-7-14(12)21-18(20)23;/h3-7,11,13,15-17H,1,8-10H2,2H3,(H,21,23);1H/t11?,13?,15?,16?,17-,19+,20+;/m1./s1
InChI key:InChIKey=AVNIVHTXRYXBIV-WMTURVKQSA-N
SMILES:O=C1[C@@]2([C@@]3([C@]4(C=C)[C@@]5(C[C@]2(OC[C@@]5([C@]3(N(C)C4)[H])[H])[H])[H])[H])C=6C(N1)=CC=CC6.Cl
Synonyms:- (3S,3aR,4S)-3-ethenyl-1-methyl-2,3,3a,7,8,8a-hexahydro-1H,5H-spiro[3,8,5-(ethane[1,1,2]triyl)oxepino[4,5-b]pyrrole-4,3'-indol]-2'(1'H)-one hydrochloride (1:1)
- Gelsemine HCl
- Gelsemine hydrochloride
- Gesemine hydrochloride
- Hsdb 3551
- Spiro[3,5,8-ethanylylidene-1H-pyrano[3,4-c]pyridine-10,3′-[3H]indole], gelsemine deriv.
- Gelsemine, monohydrochloride
- Gelsemine hydrochlorideQ: What is
- (3S,8S)-1-methyl-3-vinyl-(4at,9at)-octahydro-spiro[3r,9c-cyclo-4c,7c-methano-oxepino[4,3-b]pyridine-8,3'-indolin]-2'-one
- Gelsemine hydrochloride Q: What is the CAS Number of
- GELSEMINE HCl(P)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Gelsemine hydrochloride
CAS:Gelsemine hydrochloride analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H22N2O2HClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:358.87Gelsemine hydrochloride
CAS:Gelsemine hydrochloride is an indole alkaloid, which is a product derived from the Gelsemium sempervirens plant, a member of the Loganiaceae family. This compound primarily originates from the roots and foliage of this flowering plant and is known for its potent physiological effects. It acts as an agonist of glycine receptors and can modulate ion channels in the central nervous system. By interacting with these receptors, gelsemine hydrochloride influences neuronal signaling pathways, leading to its characteristic biological effects.Formula:C20H23ClN2O2Purity:Min. 95%Molecular weight:358.9 g/mol

