CAS 35310-75-9

1-(3-Bromo-4-methoxyphenyl)ethanone

Description:

1-(3-Bromo-4-methoxyphenyl)ethanone, with the CAS number 35310-75-9, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of a bromine atom and a methoxy group on the phenyl ring contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its moderate solubility in organic solvents. The bromine substituent can enhance electrophilic aromatic substitution reactions, while the methoxy group can influence the compound's electronic properties and steric hindrance. As a ketone, it can participate in various chemical reactions, including nucleophilic addition and condensation reactions. Its structural features make it of interest in medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₉BrO₂

InChI: InChI=1/C9H9BrO2/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-5H,1-2H3

SMILES: CC(=O)c1ccc(c(c1)Br)OC

Synonyms:

• Ethanone, 1-(3-bromo-4-methoxyphenyl)-
• 1-(3-Bromo-4-Methoxyphenyl)Ethan-1-One

1-(3-Bromo-4-methoxyphenyl)ethanone

CAS: 35310-75-9

Formula: C₉H₉BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.0706

Ref: IN-DA0033KC

3'-Bromo-4'-methoxyacetophenone

CAS: 35310-75-9

3'-Bromo-4'-methoxyacetophenone

Formula: C₉H₉BrO₂

Purity: 98%

Color and Shape: beige solid

Molecular weight: 229.07056g/mol

Ref: 54-OR14758

1-(3-Bromo-4-methoxyphenyl)ethanone

CAS: 35310-75-9

Formula: C₉H₉BrO₂

Purity: 97%

Color and Shape: Solid, Off-white powder

Molecular weight: 229.073

Ref: 10-F015345