CAS 35320-22-0
:D-Alaninamide
Description:
D-Alaninamide, with the CAS number 35320-22-0, is an amino acid derivative characterized by its amide functional group attached to the alanine structure. It is a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar nature due to the presence of both amino and amide groups. D-Alaninamide is a chiral compound, existing in a specific stereoisomeric form, which can influence its biological activity and interactions. This compound is often utilized in biochemical research and pharmaceutical applications, particularly in the synthesis of peptides and as a building block in drug development. Its stability under various conditions makes it suitable for various laboratory applications. Additionally, D-Alaninamide may exhibit biological properties, including potential roles in metabolic pathways or as a precursor in the synthesis of other biologically active molecules. As with many amino acid derivatives, it is important to handle D-Alaninamide with care, following appropriate safety protocols in laboratory settings.
Formula:C3H8N2O
InChI:InChI=1/C3H8N2O/c1-2(4)3(5)6/h2H,4H2,1H3,(H2,5,6)/t2-/m1/s1
SMILES:C[C@H](C(=N)O)N
Synonyms:- (2R)-2-Aminopropanamide
- propanamide, 2-amino-, (2R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(R)-2-Aminopropanamide
CAS:Formula:C3H8N2OPurity:97%Color and Shape:Solid, No data available.Molecular weight:88.11(2R)-2-Aminopropanamide
CAS:<p>(2R)-2-Aminopropanamide is a chemical compound that is classified as an amide. It has been shown to inhibit bacterial growth and induce apoptosis in mammalian cells, but not in bacteria. This drug has a number of hydrogen bonding interactions with the carbonyl group and amide functional groups and can bind to affinity ligands with hydrogen bonding interactions. (2R)-2-Aminopropanamide inhibits the activity of enzymes that are involved in the synthesis of d-alanine, which is a precursor for protein synthesis. It also inhibits the enzyme glutamine synthase, which plays a key role in building up nitrogen reserves in bacteria. The drug binds to DNA by forming hydrogen bonds with the phosphate backbone and intercalates into double-stranded DNA by forming van der Waals interactions with base pairs.</p>Formula:C3H8N2OPurity:Min. 95%Molecular weight:88.11 g/mol
