
CAS 35334-12-4
:Azidocillin sodium
Description:
Azidocillin sodium is a synthetic antibiotic belonging to the penicillin class, characterized by its broad-spectrum antibacterial activity. It is primarily effective against various Gram-positive and some Gram-negative bacteria. The compound features a beta-lactam ring, which is essential for its mechanism of action, as it inhibits bacterial cell wall synthesis, leading to cell lysis and death. Azidocillin sodium is typically administered via injection and is soluble in water, making it suitable for parenteral use. Its chemical structure includes an azido group, which distinguishes it from other penicillins and contributes to its unique properties. The substance is generally used in clinical settings to treat infections caused by susceptible organisms, although resistance can occur. As with other antibiotics, it is important to use Azidocillin sodium judiciously to minimize the development of antibiotic resistance. Safety and efficacy profiles should be considered, and potential side effects may include allergic reactions, gastrointestinal disturbances, and effects on renal function.
Formula:C16H17N5O4S·Na
InChI:InChI=1S/C16H17N5O4S.Na/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8;/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25);/t9-,10-,11+,14-;/m1./s1
InChI key:InChIKey=YVPBURKILVGCNS-YWUHCJSESA-N
SMILES:C(O)(=O)[C@@H]1N2[C@@]([C@H](NC([C@H](N=[N+]=[N-])C3=CC=CC=C3)=O)C2=O)(SC1(C)C)[H].[Na]
Synonyms:- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(2R)-azidophenylacetyl]amino]-3,3-dimethyl-7-oxo-, monosodium salt, (2S,5R,6R)-
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[(azidophenylacetyl)amino]-3,3-dimethyl-7-oxo-, monosodium salt, [2S-[2α,5α,6β(S*)]]-
- Azidocillin sodium
- Sodium azidocillin
- Azidocillin sodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Azidocillin sodium salt
CAS:Azidocillin sodium salt is a type of penicillin.Formula:C16H16N5NaO4SColor and Shape:SolidMolecular weight:397.38
