CAS 35335-16-1: 1,4-Dibromo-2,5-bis(brommethyl)-benzene

Description:1,4-Dibromo-2,5-bis(bromomethyl)-benzene, with the CAS number 35335-16-1, is an organic compound characterized by its aromatic structure featuring a benzene ring substituted with bromine and bromomethyl groups. This compound typically exhibits a high degree of bromination, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of multiple bromine atoms enhances its electrophilic character, making it useful in various chemical reactions, including cross-coupling and polymerization processes. Additionally, the compound may display significant thermal stability due to the strength of the carbon-bromine bonds. Its physical properties, such as melting and boiling points, are influenced by the degree of bromination and the overall molecular structure. As with many brominated compounds, it is essential to handle 1,4-Dibromo-2,5-bis(bromomethyl)-benzene with care due to potential toxicity and environmental concerns associated with brominated organic compounds. Proper safety measures should be observed during its use in laboratory or industrial settings.

Formula:C₈H₆Br₄

InChI:InChI=1/C8H6Br4/c9-3-5-1-7(11)6(4-10)2-8(5)12/h1-2H,3-4H2

Synonyms:
1,4-Dibromo-2,5-Bis(Bromomethyl)Benzene
1,4-Dibromo-2,5-bis(brommethyl)benzene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1,4-Dibromo-2,5-bis(bromomethyl)benzene REF: 3B-D3961CAS: 35335-16-1	>97.0%(GC)	113.00 €~358.00 €	Fri 04 Apr 25
1,4-Dibromo-2,5-bis(bromomethyl)benzene REF: IN-DA0032MMCAS: 35335-16-1	98%	32.00 €~526.00 €	Fri 11 Apr 25
1,4-Bis(bromomethyl)-2,5-dibromobenzene REF: 54-OR11479CAS: 35335-16-1	98%	37.00 €~3,764.00 €	Mon 14 Apr 25
1,4-Dibromo-2,5-bis(bromomethyl)benzene REF: 10-F761608CAS: 35335-16-1	98%	58.00 €~226.00 €	Mon 14 Apr 25
1,4-Bis(bromomethyl)-2,5-dibromobenzene REF: 3D-FB32287CAS: 35335-16-1	Min. 95%	- - -	Discontinued product