CAS 35340-62-6
:2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid
Description:
2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid, with the CAS number 35340-62-6, is a chemical compound that features a unique structure characterized by an isoindole moiety and a butanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the dioxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Its molecular structure may impart specific solubility characteristics, influencing its behavior in different solvents. Additionally, compounds of this nature can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of functional groups such as carboxylic acids can also affect its acidity and reactivity. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C12H11NO4
InChI:InChI=1/C12H11NO4/c1-2-9(12(16)17)13-10(14)7-5-3-4-6-8(7)11(13)15/h3-6,9H,2H2,1H3,(H,16,17)
SMILES:CCC(C(=O)O)N1C(=O)c2ccccc2C1=O
Synonyms:- 2H-Isoindole-2-acetic acid, alpha-ethyl-1,3-dihydro-1,3-dioxo-
- 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(1,3-DIOXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)BUTANOIC ACID
CAS:Formula:C12H11NO4Molecular weight:233.22002-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid
CAS:Formula:C12H11NO4Color and Shape:SolidMolecular weight:233.223

