CAS 353465-22-2
:1-(3-methoxybenzoyl)piperidine-4-carboxylic acid
Description:
1-(3-Methoxybenzoyl)piperidine-4-carboxylic acid is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The structure features a methoxybenzoyl group attached to the piperidine nitrogen, contributing to its aromatic properties and potential biological activity. The presence of a carboxylic acid functional group enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. This compound may exhibit interesting pharmacological properties, as many piperidine derivatives are known for their roles in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. The compound's CAS number, 353465-22-2, allows for easy identification and retrieval of information in chemical databases. Overall, 1-(3-methoxybenzoyl)piperidine-4-carboxylic acid represents a versatile scaffold for further research in both synthetic and medicinal chemistry.
Formula:C14H17NO4
InChI:InChI=1/C14H17NO4/c1-19-12-4-2-3-11(9-12)13(16)15-7-5-10(6-8-15)14(17)18/h2-4,9-10H,5-8H2,1H3,(H,17,18)
SMILES:COc1cccc(c1)C(=O)N1CCC(CC1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(3-Methoxybenzoyl)piperidine-4-carboxylic acid
CAS:<p>1-(3-Methoxybenzoyl)piperidine-4-carboxylic acid is a fine chemical that can be used as a building block in organic synthesis. It has CAS No. 353465-22-2 and is also known as P1. This compound is useful in the preparation of a variety of complex compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. The compound can be used as a reagent or intermediate for reactions such as Friedel-Crafts acylation, carbonylation, and sulfonylation. 1-(3-Methoxybenzoyl)piperidine-4-carboxylic acid is also an excellent scaffold for the synthesis of complex molecules with versatile functional groups.</p>Formula:C14H17NO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:263.29 g/mol
