CAS 3535-30-6
:4-Ethoxy-3-methoxybenzoic acid
Description:
4-Ethoxy-3-methoxybenzoic acid, with the CAS number 3535-30-6, is an aromatic carboxylic acid characterized by the presence of both ethoxy and methoxy functional groups attached to a benzoic acid core. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and acetone, while having limited solubility in water. The presence of the ethoxy and methoxy groups contributes to its unique chemical properties, including potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The compound may also exhibit moderate acidity due to the carboxylic acid group, influencing its reactivity and interactions in various chemical environments. Additionally, its structural features may allow for specific interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-3-14-8-5-4-7(10(11)12)6-9(8)13-2/h4-6H,3H2,1-2H3,(H,11,12)
InChI key:InChIKey=LBYKODYNFRCBIR-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCC)C=CC(C(O)=O)=C1
Synonyms:- 3-Methoxy-4-ethoxybenzoic acid
- 4-Ethoxy-3-Methoxybenzoate
- 4-Ethoxy-3-Methoxybenzoic Acid
- Benzoic acid, 4-ethoxy-3-methoxy-
- NSC 243739
- Vanillic acid ethyl ether
- 4-Ethoxy-m-anisic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Ethoxy-3-methoxybenzoic acid
CAS:Formula:C10H12O4Purity:95%Color and Shape:SolidMolecular weight:196.19994-Ethoxy-3-methoxybenzoic acid
CAS:4-Ethoxy-3-methoxybenzoic acidPurity:98%Molecular weight:196.20g/mol4-Ethoxy-3-methoxybenzoic acid
CAS:4-Ethoxy-3-methoxybenzoic acid is a white crystalline solid that belongs to the class of isomers. This compound has been used in biological studies to study the functional theory of bond cleavage, hydroxyl group, and cleavage products. 4-Ethoxy-3-methoxybenzoic acid has also been shown to be a substrate for radical chain reactions, which are initiated by electron transfer from an organic molecule and may produce hydroperoxides or peroxides. The fatty acids found in this chemical react with trichloroacetic acid to form esters and conjugates. These esters are more water soluble than the original fatty acids, making them useful as solvents for organic reactions. 4-Ethoxy-3-methoxybenzoic acid is a precursor for coriolus pigment, which provides coloration for coniferous trees such as pine and spruce.Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/mol



