CAS 3535-35-1
:3-methoxy-4-(2-methylpropoxy)benzoic acid
Description:
3-Methoxy-4-(2-methylpropoxy)benzoic acid, with the CAS number 3535-35-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a branched alkoxy side chain. This compound features a benzoic acid moiety, indicating the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its biological activity. The 2-methylpropoxy group adds steric bulk, which can affect the compound's interactions with biological targets or its physical properties, such as boiling and melting points. Generally, compounds like this may exhibit moderate to high lipophilicity due to the presence of alkyl chains, which can influence their pharmacokinetics if they are studied for medicinal purposes. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, making it a candidate for further synthetic modifications or applications in pharmaceuticals or agrochemicals.
Formula:C12H16O4
InChI:InChI=1/C12H16O4/c1-8(2)7-16-10-5-4-9(12(13)14)6-11(10)15-3/h4-6,8H,7H2,1-3H3,(H,13,14)
SMILES:CC(C)COc1ccc(cc1OC)C(=O)O
Synonyms:- 4-Isobutoxy-3-methoxybenzoic acid
- 4-Isobutoxy-3-methoxy-benzoic acid
- Benzoic Acid, 3-Methoxy-4-(2-Methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
