CymitQuimica logo

CAS 35351-49-6

:

7-methoxy-1-benzofuran-2-carbonitrile

Description:
7-Methoxy-1-benzofuran-2-carbonitrile is an organic compound characterized by its unique structure, which includes a benzofuran moiety and a nitrile functional group. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound typically exhibits a moderate to high melting point and is likely to be stable under standard laboratory conditions. Its nitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making it a versatile intermediate in organic synthesis. Additionally, compounds with benzofuran structures are often studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities. The compound's CAS number, 35351-49-6, allows for easy identification and retrieval of information in chemical databases. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C10H7NO2
InChI:InChI=1/C10H7NO2/c1-12-9-4-2-3-7-5-8(6-11)13-10(7)9/h2-5H,1H3
SMILES:COc1cccc2cc(C#N)oc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.