CymitQuimica logo

CAS 35354-37-1

:

1-Bromo-5-methylhexane

Description:
1-Bromo-5-methylhexane is an organic compound classified as a haloalkane, specifically a bromoalkane, due to the presence of a bromine atom in its structure. It features a six-carbon chain (hexane) with a methyl group attached to the fifth carbon, making it a branched alkane. The presence of the bromine atom introduces notable reactivity, allowing for nucleophilic substitution reactions, which are characteristic of haloalkanes. This compound is typically a colorless to pale yellow liquid at room temperature and has a relatively low boiling point compared to more complex organic compounds. Its molecular formula is C7H15Br, and it exhibits hydrophobic properties, making it insoluble in water but soluble in organic solvents. 1-Bromo-5-methylhexane can be used in various chemical syntheses and as an intermediate in the production of other organic compounds. Safety precautions should be taken when handling this substance, as brominated compounds can be hazardous and may pose environmental risks.
Formula:C7H15Br
InChI:InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3
InChI key:XAOFMTDKQYEOES-UHFFFAOYSA-N
SMILES:CC(C)CCCCBr
Found 6 products.