CAS 35358-78-2
:Benzenediazonium, 2-(methoxycarbonyl)-, chloride (1:1)
Description:
Benzenediazonium, 2-(methoxycarbonyl)-, chloride (1:1), with the CAS number 35358-78-2, is an organic compound characterized by the presence of a diazonium group attached to a benzene ring, along with a methoxycarbonyl substituent. This compound typically appears as a stable, crystalline solid and is soluble in polar organic solvents. The diazonium group is known for its reactivity, particularly in electrophilic aromatic substitution reactions, allowing for the introduction of various substituents onto the benzene ring. The methoxycarbonyl group, which is an ester functional group, can influence the compound's reactivity and stability. The chloride ion in the structure serves as a counterion, balancing the positive charge of the diazonium moiety. This compound is often utilized in synthetic organic chemistry, particularly in the preparation of azo compounds and other derivatives through coupling reactions. Safety precautions should be observed when handling diazonium compounds due to their potential reactivity and toxicity.
Formula:C8H7N2O2·Cl
InChI:InChI=1S/C8H7N2O2.ClH/c1-12-8(11)6-4-2-3-5-7(6)10-9;/h2-5H,1H3;1H/q+1;/p-1
InChI key:InChIKey=KWSYAQIUNJVRCA-UHFFFAOYSA-M
SMILES:C(OC)(=O)C1=C([N+]#N)C=CC=C1.[Cl-]
Synonyms:- Benzenediazonium, 2-(methoxycarbonyl)-, chloride
- Benzenediazonium, 2-(methoxycarbonyl)-, chloride (1:1)
- Methyl 2-(2-chlorodiazenyl)benzoate
- 2-(Methoxycarbonyl)benzenediazonium chloride
- 2-(Carbomethoxy)benzenediazonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl 2-disazobenzoate hydrochloride
CAS:Methyl 2-disazobenzoate hydrochloride is a drug product that is used as an HPLC standard and as a metabolite in the development of drugs. It has been found to be naturally occurring and is a research and development metabolite. Methyl 2-disazobenzoate hydrochloride is also an impurity of API, which can be quantified in analytical studies. It is a synthetic compound with CAS No. 35358-78-2 and it can be used to manufacture high purity pharmaceuticals. Methyl 2-disazobenzoate hydrochloride has been shown to have niche pharmacological effects, such as anti-inflammatory activities.Formula:C8H7N2O2ClPurity:Min. 95%Molecular weight:198.61 g/mol
