CAS 35359-23-0

[1,2,4]triazolo[4,3-a]quinoline-1(2H)-thione

Description:

[1,2,4]triazolo[4,3-a]quinoline-1(2H)-thione is a heterocyclic compound characterized by its unique triazole and quinoline structures. This compound features a triazole ring fused to a quinoline moiety, which contributes to its potential biological activity. The presence of a thione functional group (a sulfur atom double-bonded to a carbon atom) enhances its reactivity and may influence its interaction with biological targets. Typically, compounds of this nature exhibit a range of properties, including potential antimicrobial, antifungal, or anticancer activities, making them of interest in medicinal chemistry. The molecular structure allows for various substitution patterns, which can further modify its chemical behavior and biological efficacy. Additionally, the compound may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, [1,2,4]triazolo[4,3-a]quinoline-1(2H)-thione represents a class of compounds with significant potential for research and application in pharmaceuticals and agrochemicals.

Formula: C₁₀H₇N₃S

InChI: InChI=1/C10H7N3S/c14-10-12-11-9-6-5-7-3-1-2-4-8(7)13(9)10/h1-6H,(H,12,14)

SMILES: c1ccc2c(c1)ccc1nnc(n21)S

[1,2,4]triazolo[4,3-a]quinoline-1(2H)-thione

CAS: 35359-23-0

Purity: 95.0%

Molecular weight: 201.25

Ref: 10-F494599