CAS 35364-79-5
:3,4-Dichlorophenethylalcohol
Description:
3,4-Dichlorophenethylalcohol, with the CAS number 35364-79-5, is an organic compound characterized by the presence of a phenethyl alcohol structure substituted with two chlorine atoms at the 3 and 4 positions of the phenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in water and good solubility in organic solvents, which makes it useful in various chemical applications. The presence of the hydroxyl (-OH) group contributes to its potential as a precursor in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the chlorinated aromatic structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as chlorinated compounds can exhibit toxicity and environmental persistence. Overall, 3,4-Dichlorophenethylalcohol is a compound of interest in both industrial and research settings due to its unique chemical properties.
Formula:C8H8Cl2O
InChI:InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2
SMILES:c1cc(c(cc1CCO)Cl)Cl
Synonyms:- 2-(3,4-Dichlorophenyl)Ethanol
- 3,4-Dichlorophenethyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(3,4-Dichlorophenyl)ethanol
CAS:Formula:C8H8Cl2OPurity:>96.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:191.05Benzeneethanol, 3,4-dichloro-
CAS:Formula:C8H8Cl2OPurity:97%Color and Shape:LiquidMolecular weight:191.05452-(3,4-Dichlorophenyl)ethanol
CAS:2-(3,4-Dichlorophenyl)ethanolPurity:98%Molecular weight:191.05g/mol3,4-Dichlorophenethyl alcohol
CAS:Formula:C8H8Cl2OPurity:97%Color and Shape:Liquid, OilMolecular weight:191.052-(3,4-Dichlorophenyl)ethanol
CAS:2-(3,4-Dichlorophenyl)ethanol is a high quality reagent for the synthesis of complex compounds, useful as an intermediate in organic synthesis and as a building block for speciality chemicals. This chemical is also used as a research chemical in the synthesis of versatile building blocks. It can be used as a reaction component in various reactions such as Suzuki coupling, Negishi coupling, Heck reaction, and Sonogashira coupling.Formula:C8H8Cl2OPurity:Min. 95%Molecular weight:191.05 g/mol




