CAS 3537-09-5

6-nitro-3H-imidazo[4,5-b]pyridine

Description:

6-Nitro-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, with a nitro group positioned at the 6th carbon of the imidazole ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the nitro group can influence its reactivity and interactions with biological targets. Additionally, this compound may participate in various chemical reactions, including nucleophilic substitutions and reductions, due to the electron-withdrawing nature of the nitro group. Its unique structure and properties make it of interest in research related to drug design and development, particularly in the context of targeting specific biological pathways or mechanisms. Safety and handling precautions should be observed, as with many nitro-containing compounds, due to potential toxicity and environmental concerns.

Formula: C₆H₄N₄O₂

InChI: InChI=1/C6H4N4O2/c11-10(12)4-1-5-6(7-2-4)9-3-8-5/h1-3H,(H,7,8,9)

SMILES: c1c(cnc2c1nc[nH]2)N(=O)=O

Synonyms:

• 3H-Imidazo[4,5-b]pyridine, 6-nitro-
• 6-Nitro-3H-imidazo[4,5-b]pyridine

6-Nitro-3H-imidazo[4,5-b]pyridine

CAS: 3537-09-5

Formula: C₆H₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1216

Ref: IN-DA00CM1D

6-Nitro-3H-imidazo[4,5-b]pyridine

CAS: 3537-09-5

Formula: C₆H₄N₄O₂

Purity: 95%

Molecular weight: 164.124

Ref: 10-F233494