CAS 35377-06-1

ethyl bicyclo[2.2.2]octane-2-carboxylate

Description:

Ethyl bicyclo[2.2.2]octane-2-carboxylate is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.2]octane framework with a carboxylate ester functional group. This compound features a carboxylate group (-COOEt) attached to the second carbon of the bicyclic system, contributing to its reactivity and potential applications in organic synthesis. The bicyclic structure imparts unique steric and electronic properties, making it a valuable intermediate in the synthesis of various organic compounds. Ethyl bicyclo[2.2.2]octane-2-carboxylate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its chemical behavior is influenced by the presence of the ester group, which can undergo hydrolysis, transesterification, and other reactions typical of esters. This compound may be utilized in the development of pharmaceuticals, agrochemicals, or as a building block in materials science due to its structural characteristics and functional versatility.

Formula: C₁₁H₁₈O₂

InChI: InChI=1/C11H18O2/c1-2-13-11(12)10-7-8-3-5-9(10)6-4-8/h8-10H,2-7H2,1H3

SMILES: CCOC(=O)C1CC2CCC1CC2

Synonyms:

• Bicyclo[2.2.2]octane-2-carboxylic acid, ethyl ester

ethyl bicyclo[2.2.2]octane-2-carboxylate

CAS: 35377-06-1

ethyl bicyclo[2.2.2]octane-2-carboxylate

Purity: ≥95%

Molecular weight: 182.25942g/mol

Ref: 54-OR22910