CymitQuimica logo

CAS 353773-37-2

:

N-(2,3-dimethoxybenzyl)-1,2,3,4-tetrahydronaphthalen-1-amine

Description:
N-(2,3-dimethoxybenzyl)-1,2,3,4-tetrahydronaphthalen-1-amine, identified by its CAS number 353773-37-2, is a chemical compound that belongs to the class of amines. This substance features a tetrahydronaphthalene core, which is a bicyclic structure known for its hydrophobic properties, making it potentially useful in various organic synthesis applications. The presence of the 2,3-dimethoxybenzyl group introduces additional functional characteristics, such as increased lipophilicity and potential for specific interactions in biological systems. The methoxy groups can also influence the compound's reactivity and solubility. As an amine, it may participate in hydrogen bonding and can act as a nucleophile in chemical reactions. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile.
Formula:C19H23NO2
InChI:InChI=1/C19H23NO2/c1-21-18-12-6-9-15(19(18)22-2)13-20-17-11-5-8-14-7-3-4-10-16(14)17/h3-4,6-7,9-10,12,17,20H,5,8,11,13H2,1-2H3
SMILES:COc1cccc(CNC2CCCc3ccccc23)c1OC
Synonyms:
  • (2,3-Dimethoxy-benzyl)-(1,2,3,4-tetrahydro-naphthalen-1-yl)-amine
  • 1-naphthalenamine, N-[(2,3-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.