CAS 353778-46-8
:N-[(4-methoxynaphthalen-1-yl)methyl]cyclopentanamine
Description:
N-[(4-methoxynaphthalen-1-yl)methyl]cyclopentanamine, with the CAS number 353778-46-8, is an organic compound characterized by its unique structure that combines a cyclopentanamine moiety with a 4-methoxynaphthyl group. This compound features a cyclopentane ring, which contributes to its cyclic structure, and an amine functional group, indicating potential basic properties. The presence of the methoxy group on the naphthalene ring enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and aliphatic components. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the naphthalene derivative may play a role in receptor binding or biological activity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further studies.
Formula:C17H21NO
InChI:InChI=1/C17H21NO/c1-19-17-11-10-13(12-18-14-6-2-3-7-14)15-8-4-5-9-16(15)17/h4-5,8-11,14,18H,2-3,6-7,12H2,1H3
SMILES:COc1ccc(CNC2CCCC2)c2ccccc12
Synonyms:- 1-naphthalenemethanamine, N-cyclopentyl-4-methoxy-
- N-[(4-Methoxy-1-naphthyl)methyl]cyclopentanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.