CAS 353779-52-9

1-(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)methanamine

Description:

1-(1,3-benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)methanamine, with the CAS number 353779-52-9, is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as potential solubility in organic solvents and moderate polarity. The presence of the benzodioxole group may impart unique electronic properties, potentially influencing its reactivity and interactions with biological targets. The pyridine ring contributes to the compound's basicity and can participate in hydrogen bonding, making it relevant in medicinal chemistry and drug design. Additionally, this compound may exhibit biological activity, which could be explored in pharmacological studies. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities would require empirical investigation. Overall, this compound represents a class of organic molecules with diverse potential applications due to its unique structural characteristics.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1/C14H14N2O2/c1-2-13-14(18-10-17-13)7-12(1)9-16-8-11-3-5-15-6-4-11/h1-7,16H,8-10H2

SMILES: c1cc2c(cc1CNCc1ccncc1)OCO2

Synonyms:

• 4-Pyridinemethanamine, N-(1,3-benzodioxol-5-ylmethyl)-
• 1-(1,3-Benzodioxol-5-yl)-N-(pyridin-4-ylmethyl)methanamine

Benzo[1,3]dioxol-5-ylmethyl-pyridin-4-ylmethyl-amine

CAS: 353779-52-9

Versatile small molecule scaffold

Formula: C₁₄H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-DPA77952