CAS 35380-71-3
:Estradiol hemihydrate
Description:
Estradiol hemihydrate is a synthetic form of the naturally occurring estrogen estradiol, commonly used in hormone replacement therapy and various medical applications. It is characterized by its molecular formula, which includes a hemihydrate form indicating the presence of water molecules associated with the compound. Estradiol hemihydrate typically appears as a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. The substance exhibits estrogenic activity, binding to estrogen receptors and influencing various physiological processes, including reproductive functions and bone density regulation. Its pharmacological effects are significant in treating conditions related to estrogen deficiency, such as menopausal symptoms and certain types of hormone-sensitive cancers. Safety and efficacy profiles are well-studied, and it is essential to consider potential side effects and contraindications when prescribing this compound. As with all medications, proper dosage and administration are crucial for achieving therapeutic benefits while minimizing risks.
Formula:C18H24O2H2O
InChI:InChI=1S/C18H24O2.H2O/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1H2/t14-,15-,16+,17+,18+;/m1./s1
InChI key:InChIKey=QJNCGXGNKJUDEM-CMZLOHJFSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(O)=CC4)(CC1)[H])[H])(CC[C@@H]2O)[H].O
Synonyms:- (17Beta)-Estra-1,3,5(10)-Triene-3,17-Diol Hydrate (2:1)
- Estra-1,3,5(10)-triene-3,17-diol (17beta)-, hydrate (2:1)
- Estra-1,3,5(10)-triene-3,17-diol (17β)-, hydrate (2:1)
- Estra-1,3,5(10)-triene-3,17beta-diol hydrate (2:1)
- Estrasorb
- Unii-Cxy7B3Q98Z
- beta-Estradiol hemihydrate
- beta-Estradiol semihydrate
- β-Estradiol hemihydrate
- β-Estradiol semihydrate
- Estradiol hemihydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Estradiol hemihydrate
CAS:Estradiol hemihydrateFormula:C18H24O2Purity:96.3%Color and Shape:WhiteMolecular weight:272.17763ESTRADIOL HEMIHYDRATE CRS
CAS:<p>ESTRADIOL HEMIHYDRATE CRS</p>Formula:C18H24O2Color and Shape:Crystalline Powder. White. Powder.Molecular weight:272.382Estradiol
CAS:Estrogens and progestinsFormula:C18H24O2H2OColor and Shape:White Cream Crystalline Powder CrystalsMolecular weight:281.39Estradiol hemihydrate
CAS:<p>Estradiol hemihydrate: major female hormone, boosts neural differentiation, studied for cancer and neurodegenerative disease.</p>Formula:C18H26O3Color and Shape:SolidMolecular weight:281.39Estradiol hemihydrate
CAS:Controlled Product<p>Estradiol hemihydrate is a synthetic estrogen. It binds to estrogen receptors, causing the activation of DNA transcription and synthesis of messenger RNA. Estradiol hemihydrate has been used for the treatment of various symptoms, such as menopause, osteoporosis, breast cancer, and metabolic disorders. The drug is most often administered by injection or in a polymeric matrix that dissolves slowly in the mouth. The recommended dose is between 0.5mg and 1mg per day. Estradiol hemihydrate can be detected in plasma using an analytical method called liquid chromatography-tandem mass spectrometry (LC-MS/MS).</p>Formula:(C18H24O2)2•H2OPurity:Min. 95%Color and Shape:PowderMolecular weight:562.78 g/mol








