CAS 35387-93-0
:Methyl 3-iodo-4-methoxybenzoate
Description:
Methyl 3-iodo-4-methoxybenzoate is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and an iodine substituent on the benzene ring. This compound belongs to the class of benzoates, specifically esters derived from benzoic acid. Its molecular formula typically includes carbon, hydrogen, oxygen, and iodine, reflecting its functional groups. The presence of the methoxy group contributes to its solubility in organic solvents and can influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The iodine atom serves as a good leaving group, making the compound useful in synthetic organic chemistry. Methyl 3-iodo-4-methoxybenzoate may exhibit biological activity, which can be explored in medicinal chemistry contexts. Additionally, its physical properties, such as melting point and boiling point, are influenced by its molecular structure and can vary based on purity and environmental conditions. Overall, this compound is of interest for its potential applications in synthesis and research.
Formula:C9H9IO3
InChI:InChI=1/C9H9IO3/c1-12-8-4-3-6(5-7(8)10)9(11)13-2/h3-5H,1-2H3
SMILES:COc1ccc(cc1I)C(=O)OC
Synonyms:- 3-Iodo-4-methoxybenzoic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 3-Iodo-4-methoxybenzoate
CAS:Formula:C9H9IO3Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:292.07Methyl 3-iodo-4-methoxybenzoate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9IO3Purity:98%Color and Shape:Powder, WhiteMolecular weight:292.07Methyl 3-iodo-4-methoxybenzoate
CAS:Formula:C9H9IO3Purity:95%Color and Shape:SolidMolecular weight:292.0704methyl 3-iodo-4-methoxybenzoate
CAS:methyl 3-iodo-4-methoxybenzoatePurity:99%Molecular weight:292.07043g/molMethyl 3-iodo-4-methoxybenzoate
CAS:Methyl 3-iodo-4-methoxybenzoate is a radioactive compound that has been shown to have pharmacological properties. It is used in the treatment of cancer and has demonstrated cytotoxic effects on tumor cells. Methyl 3-iodo-4-methoxybenzoate binds to the cell membrane and causes changes in membrane permeability, leading to cell death. This compound also demonstrates affinity for 4-ibp, a receptor found on cancer cells.Formula:C9H9IO3Purity:Min. 95%Molecular weight:292.07 g/molMethyl 3-iodo-4-methoxybenzoate
CAS:Formula:C9H9IO3Purity:95%Color and Shape:SolidMolecular weight:292.072





