CAS 354-56-3
:1,1,1,2,2-Pentachloro-2-fluoroethane
Description:
1,1,1,2,2-Pentachloro-2-fluoroethane, with the CAS number 354-56-3, is a halogenated organic compound primarily used as a solvent and in various industrial applications. This substance is characterized by its high chlorine content, which contributes to its stability and effectiveness as a solvent, particularly in the cleaning and degreasing of metals. It is a colorless liquid at room temperature and has a relatively low boiling point, making it volatile. The presence of both chlorine and fluorine atoms in its structure imparts unique chemical properties, including resistance to degradation and a tendency to participate in reactions typical of halogenated compounds. However, due to its environmental impact, particularly concerning ozone depletion and potential toxicity, its use is regulated in many countries. Safety precautions are essential when handling this compound, as it can pose health risks through inhalation or skin contact. Overall, 1,1,1,2,2-Pentachloro-2-fluoroethane exemplifies the complexities associated with halogenated solvents in industrial chemistry.
Formula:C2Cl5F
InChI:InChI=1S/C2Cl5F/c3-1(4,5)2(6,7)8
InChI key:InChIKey=KQKBWZDTYSQPMD-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)F)(Cl)(Cl)Cl
Synonyms:- 1,1,1,2,2-Pentachloro-2-Fluoroethane
- Cfc-111
- Ethane, 1,1,1,2,2-pentachloro-2-fluoro-
- Ethane, pentachlorofluoro-
- Freon 111
- Freon 112a
- Pentachlorofluoroethane
- Fluoropentachloroethane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Fluoropentachloroethane
CAS:Controlled Product<p>Fluoropentachloroethane is a reactive compound that reacts with water to form hydrofluoric acid and pentachloroethane. It is used in the production of other compounds, such as solvents, refrigerants and pesticides. Fluoropentachloroethane is also used as an extracting agent in organic chemistry and has been shown to be effective at removing heavy metals from contaminated water. The chemical has a vapor pressure of 1.6 mmHg at 20 degrees Celsius and a density of 1.598 g/mL, which makes it easier to transport by land or air than heavier chemicals such as tetrachloroethylene. Fluoropentachloroethane can be evaporated using diode laser technology when the temperature is above its boiling point of 65 degrees Celsius.</p>Formula:C2Cl5FPurity:Min. 95%Color and Shape:SolidMolecular weight:220.28 g/mol
