CAS 35404-50-3
:2-imino-1-imidazolidineacetic acid
Description:
2-Imino-1-imidazolidineacetic acid, with the CAS number 35404-50-3, is a chemical compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound is an amino acid derivative, exhibiting both basic and acidic properties due to the presence of an imino group and a carboxylic acid functional group. It is typically a white to off-white solid and is soluble in water, which is indicative of its polar nature. The compound may participate in various biochemical processes, potentially acting as a precursor or intermediate in the synthesis of other biologically relevant molecules. Its unique structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and research. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its application and handling.
Formula:C5H9N3O2
InChI:InChI=1/C5H9N3O2/c6-5-7-1-2-8(5)3-4(9)10/h1-3H2,(H2,6,7)(H,9,10)
SMILES:C1CN(CC(=O)O)C(=N)N1
Synonyms:- Cyclocreatine
- (2-amino-4,5-dihydro-1H-imidazol-1-yl)acetic acid
- 1-Carboxymethyl-2-iminoimidazolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1H-Imidazole-1-aceticacid, 2-amino-4,5-dihydro-
CAS:Formula:C5H9N3O2Purity:97%Color and Shape:SolidMolecular weight:143.1439Cyclocreatine
CAS:Cyclocreatine, a creatine analogue and substrate for creatine kinase, inhibits creatine metabolism and prostate cancer cell proliferation.Formula:C5H9N3O2Purity:99.864%Color and Shape:SolidMolecular weight:143.14(2-Iminoimidazolidin-1-yl)acetic acid
CAS:(2-Iminoimidazolidin-1-yl)acetic acidPurity:98%Color and Shape:SolidMolecular weight:143.14g/molCyclocreatine
CAS:Cyclocreatine is a natural substance that is found in the body, which is also called creatine. Cyclocreatine has been used for the treatment of eye disorders such as glaucoma, and to help improve muscle function in people with muscular dystrophy. Cyclocreatine works by increasing the levels of adenylate cyclase, which subsequently increases the levels of cyclic AMP (cAMP) in cells. This leads to an increase in protein kinase activity, which helps to regulate cellular metabolism and energy production. Cyclocreatine also has been shown to have anti-cancer effects on carcinoma cell lines by inhibiting cellular transformation and inducing apoptosis.Formula:C5H9N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:143.14 g/molCyclocreatine
CAS:Controlled ProductApplications Cyclocreatine is used to regulate creatine biosynthesis by suppressing the level of arginine:glycine amidinotransferase in chick liver.
References McGilvery, R.W. et al.: J. Biol. Chem., 249, 1417 (1974)Formula:C5H9N3O2Color and Shape:White To Off-WhiteMolecular weight:143.14Cyclocreatine-1,4,5-13C3
CAS:Controlled ProductFormula:C213C3H9N3O2Color and Shape:NeatMolecular weight:146.12






