CAS 35405-71-1: (2S,4S,5S)-2-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Description:The chemical substance with the name "(2S,4S,5S)-2-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol" and CAS number "35405-71-1" is a complex organic compound characterized by multiple hydroxyl groups, which contribute to its hydrophilicity and potential reactivity. The presence of a bicyclic structure indicates a unique three-dimensional conformation that may influence its biological activity and interactions with other molecules. This compound is likely to exhibit properties typical of polyols, such as high solubility in water and the ability to form hydrogen bonds. Its stereochemistry, denoted by the specific configurations at various chiral centers, suggests that it may have specific interactions in biological systems, potentially serving as a substrate or inhibitor in enzymatic reactions. The intricate structure may also indicate potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical and biological contexts.
Formula:C12H20O10
InChI:InChI=1/C12H20O10/c13-1-3-5(14)6(15)8(17)12(20-3)22-10-4-2-19-11(21-4)9(18)7(10)16/h3-18H,1-2H2/t3?,4?,5-,6+,7-,8?,9?,10-,11-,12+/m1/s1
![(2S,4S,5S)-2-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-6-(hydroxymethyl)te…](https://static.cymitquimica.com/cas-image/52621-2s-4s-5s-2-2s-3r-5r-34-dihydroxy-68-dioxabicyclo-3-2-1-octan-2-yl-oxy-6-hydroxymethyl-tetrahydropyran-345-triol.png)
