CAS 354153-64-3

(βR)-β-Amino-4-bromobenzeneethanol

Description:

(βR)-β-Amino-4-bromobenzeneethanol, with the CAS number 354153-64-3, is an organic compound characterized by the presence of both an amino group and a bromobenzene moiety. This compound features a chiral center, which contributes to its stereochemical properties, specifically the (βR) configuration. The amino group (-NH2) is known for its basicity and ability to participate in hydrogen bonding, which can influence the compound's solubility and reactivity. The bromobenzene component introduces a halogen, which can enhance the compound's electrophilic character and reactivity in substitution reactions. Additionally, the presence of the hydroxyl group (-OH) in the ethanol part of the molecule contributes to its potential as a hydrogen bond donor and acceptor, affecting its interactions in biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on its interactions with biological targets and its overall chemical stability.

Formula: C₈H₁₀BrNO

InChI: InChI=1S/C8H10BrNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1-4,8,11H,5,10H2/t8-/m0/s1

InChI key: InChIKey=KTNHFPRYCCCOQV-QMMMGPOBSA-N

SMILES: [C@@H](CO)(N)C1=CC=C(Br)C=C1

Synonyms:

• (βR)-β-Amino-4-bromobenzeneethanol
• Benzeneethanol, β-amino-4-bromo-, (βR)-
• (2R)-2-Amino-2-(4-bromophenyl)ethan-1-ol
• (R)-2-(4-Bromophenyl)glycinol

(R)-b-Amino-4-bromo-benzeneethanol

CAS: 354153-64-3

Formula: C₈H₁₀BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.0751

Ref: IN-DA00CACG

(R)-b-Amino-4-bromo-benzeneethanol

CAS: 354153-64-3

(R)-b-Amino-4-bromo-benzeneethanol

Purity: 95%

Molecular weight: 216.08g/mol

Ref: 54-OR948197

(R)-2-Amino-2-(4-bromophenyl)ethan-1-ol

CAS: 354153-64-3

Purity: 97%

Molecular weight: 216.08

Ref: 10-F608196