
CAS 35418-52-1
:Schizokinen
Description:
Schizokinen, with the CAS number 35418-52-1, is a chemical compound that belongs to the class of natural products known as siderophores. Siderophores are small, high-affinity iron-chelating compounds produced by microorganisms to scavenge iron from their environment, which is essential for their growth and metabolism. Schizokinen is specifically produced by certain strains of bacteria, such as those in the genus *Bacillus*. This compound exhibits a strong ability to bind iron ions, facilitating their uptake in iron-limited conditions. Structurally, schizokinen features a complex arrangement of functional groups that contribute to its chelating properties. Its role in microbial iron acquisition highlights its importance in ecological and biotechnological contexts, particularly in understanding microbial interactions and potential applications in agriculture or medicine. Additionally, research into siderophores like schizokinen can provide insights into their mechanisms of action and potential uses in treating iron deficiency or as antimicrobial agents.
Formula:C16H28N4O9
InChI:InChI=1S/C16H28N4O9/c1-11(21)19(28)7-3-5-17-13(23)9-16(27,15(25)26)10-14(24)18-6-4-8-20(29)12(2)22/h27-29H,3-10H2,1-2H3,(H,17,23)(H,18,24)(H,25,26)
InChI key:InChIKey=YILWWVUXGMGOAM-UHFFFAOYSA-N
SMILES:C(CC(NCCCN(C(C)=O)O)=O)(CC(NCCCN(C(C)=O)O)=O)(C(O)=O)O
Synonyms:- Butanoic acid, 4-[[3-(acetylhydroxyamino)propyl]amino]-2-[2-[[3-(acetylhydroxyamino)propyl]amino]-2-oxoethyl]-2-hydroxy-4-oxo-
- 4-[[3-(Acetylhydroxyamino)propyl]amino]-2-[2-[[3-(acetylhydroxyamino)propyl]amino]-2-oxoethyl]-2-hydroxy-4-oxobutanoic acid
- Schizokinen
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Schizokinen
CAS:Schizokinen is a citrate-containing dihydroxamate and a siderophore produced by Bacillus megaterium and Anabaena sp.Formula:C16H28N4O9Color and Shape:SolidMolecular weight:420.41
