CymitQuimica logo

CAS 35419-02-4

:

1,4,6,7-tetrahydro-5H-indol-5-one

Description:
1,4,6,7-Tetrahydro-5H-indol-5-one, with the CAS number 35419-02-4, is a bicyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the indole framework, resulting in a saturated form. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the carbonyl group (C=O) in the structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophiles. This compound may exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and medicinal chemistry. Its unique structural features allow for interactions with biological targets, making it a subject of research in drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H9NO
InChI:InChI=1/C8H9NO/c10-7-1-2-8-6(5-7)3-4-9-8/h3-4,9H,1-2,5H2
SMILES:C1Cc2c(cc[nH]2)CC1=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.