CAS 3543-01-9
:3-Amino-5-hydroxypyridine
Description:
3-Amino-5-hydroxypyridine is an organic compound characterized by the presence of both amino and hydroxyl functional groups attached to a pyridine ring. Its molecular structure consists of a six-membered aromatic ring with one nitrogen atom, which contributes to its basicity and potential for hydrogen bonding. The amino group (-NH2) typically imparts basic properties, while the hydroxyl group (-OH) enhances its solubility in polar solvents and can participate in hydrogen bonding interactions. This compound is often used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, its unique functional groups allow it to engage in diverse chemical reactions, including nucleophilic substitutions and condensation reactions. The compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 3-Amino-5-hydroxypyridine is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c6-4-1-5(8)3-7-2-4/h1-3,8H,6H2
SMILES:c1c(cncc1O)N
Synonyms:- 5-Aminopyridin-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA00I719
1g113.00€5g347.00€25gTo inquire50gTo inquire100gTo inquire50mg49.00€100mg55.00€250mg67.00€3-Amino-5-hydroxypyridine
CAS:3-Amino-5-hydroxypyridinePurity:97%Color and Shape:SolidMolecular weight:110.11g/mol5-Amino-pyridin-3-ol
CAS:<p>5-Amino-pyridin-3-ol is a substance that can be used as a developer or coupler in the production of dyes. It is also used in the manufacture of pharmaceuticals and other organic compounds. 5-Amino-pyridin-3-ol is toxic to humans, and should be handled with care. It is not absorbed through the skin, but can cause skin irritation if it comes into contact with eyes or mucous membranes. 5-Amino-pyridin-3-ol has been shown to have some beneficial effects on the skin when applied topically, such as inhibiting inflammation and enhancing wound healing.</p>Formula:C5H6N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:110.11 g/mol



