CAS 3543-77-9

Ethyl 5-amino-1-methyl-1H-benzimidazole-2-pentanoate

Description:

Ethyl 5-amino-1-methyl-1H-benzimidazole-2-pentanoate, with the CAS number 3543-77-9, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance typically features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring. The presence of an ethyl ester group and an amino group contributes to its solubility and reactivity. The compound is characterized by its potential biological activity, which may include antimicrobial or anticancer properties, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions with biological targets, and it may undergo typical reactions associated with amines and esters, such as acylation or hydrolysis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry of benzimidazole derivatives and their applications in medicinal chemistry.

Formula: C₁₅H₂₁N₃O₂

InChI: InChI=1S/C15H21N3O2/c1-3-20-15(19)7-5-4-6-14-17-12-10-11(16)8-9-13(12)18(14)2/h8-10H,3-7,16H2,1-2H3

InChI key: InChIKey=ZBMXZDCGRNESMC-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CCCCC(OCC)=O)=CC(N)=CC2

Synonyms:

• 1H-Benzimidazole-2-pentanoic acid, 5-amino-1-methyl-, ethyl ester
• Ethyl 5-amino-1-methyl-1H-benzimidazole-2-pentanoate
• 2-Benzimidazolevaleric acid, 5-amino-1-methyl-, ethyl ester

Ethyl 5-(5-Amino-1-methylbenzimidazol-2-yl)pentanoate

CAS: 3543-77-9

Color and Shape: Neat

Ref: 86-MM0154.54