CAS 35444-94-1
:4-Iododiphenylmethane
Description:
4-Iododiphenylmethane, with the CAS number 35444-94-1, is an organic compound characterized by the presence of iodine and two phenyl groups attached to a central methane carbon. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the phenyl rings. The iodine atom introduces significant electronegativity, influencing the compound's reactivity and making it useful in various chemical reactions, including electrophilic substitutions. It is often utilized in organic synthesis and can serve as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of iodine also imparts unique properties, such as increased density and potential applications in imaging or as a contrast agent in medical diagnostics. However, handling this compound requires caution due to the potential toxicity associated with iodine-containing compounds. Overall, 4-Iododiphenylmethane is a valuable compound in synthetic organic chemistry, with applications that leverage its distinctive chemical characteristics.
Formula:C13H11I
InChI:InChI=1/C13H11I/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2
SMILES:c1ccc(cc1)Cc1ccc(cc1)I
Synonyms:- 1-Benzyl-4-Iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Iododiphenylmethane
CAS:<p>4-Iododiphenylmethane is an organic compound that contains the methylene group (CH2) and is a substituted diphenylmethane. It can be prepared by the substitution of a methyl group for one of the phenyl groups on the benzene ring, followed by iodination. The reaction is catalyzed by hypophosphorous acid. This product has a number of substitutions, which creates steric effects in its reactivity. 4-Iododiphenylmethane can undergo an attack at the position one carbon away from the iodine atom. This attack leads to hypoiodite as a product. 4-Iododiphenylmethane also reacts with phenyl phosphine to form biphenyl, which is one possible way it can be used in industry.</p>Formula:C13H11IPurity:Min. 95%Molecular weight:294.13 g/mol
