CAS 35447-75-7
:N-hydroxy-2-nitrobenzenecarboximidoyl chloride
Description:
N-hydroxy-2-nitrobenzenecarboximidoyl chloride, with the CAS number 35447-75-7, is a chemical compound characterized by its functional groups, including a hydroxyl group, a nitro group, and an imidoyl chloride moiety. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the imidoyl chloride group, which can participate in nucleophilic substitution reactions. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and stability. N-hydroxy-2-nitrobenzenecarboximidoyl chloride is often utilized in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its handling requires caution due to potential toxicity and reactivity, necessitating appropriate safety measures in laboratory settings. Overall, this compound exemplifies the complexity and utility of functionalized aromatic compounds in chemical research and industrial applications.
Formula:C7H5ClN2O3
InChI:InChI=1/C7H5ClN2O3/c8-7(9-11)5-3-1-2-4-6(5)10(12)13/h1-4,11H/b9-7+
Synonyms:- Benzenecarboximidoyl chloride, N-hydroxy-2-nitro-
- N-Hydroxy-2-nitrobenzenecarboximidoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
alpha-Chloro-2-nitrobenzaldoxime
CAS:<p>The heterocycle alpha-chloro-2-nitrobenzaldoxime is a functional group that can be oriented in two different ways. The diversity of the product arises from the fact that it is possible to create new functional groups by substitution on the benzene ring and on the nitrogen. Heterocyclization of alpha-chloro-2-nitrobenzaldoxime can be achieved by using other heterocycles such as isoxazoles, which are readily available in large quantities, as building blocks. This reaction can be catalyzed by reductive means with sodium borohydride and methanol.</p>Formula:C7H5ClN2O3Purity:Min. 95%Molecular weight:200.58 g/mol
