CAS 35447-78-0: 2,3-dibromo-3-(4-nitrophenyl)propanoic acid

Description: 2,3-Dibromo-3-(4-nitrophenyl)propanoic acid is an organic compound characterized by its unique structure, which includes two bromine atoms and a nitrophenyl group attached to a propanoic acid backbone. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the presence of the bulky nitrophenyl group and the bromine substituents. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The bromine atoms contribute to its reactivity, making it a potential candidate for further chemical modifications. Additionally, the nitro group can influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological systems. Overall, 2,3-dibromo-3-(4-nitrophenyl)propanoic acid is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its unique structural features.

Formula: C₉H₇Br₂NO₄

InChI: InChI=1/C9H7Br2NO4/c10-7(8(11)9(13)14)5-1-3-6(4-2-5)12(15)16/h1-4,7-8H,(H,13,14)

Synonyms:

• ALPHA,BETA-DIBROMO-4-NITROHYDROCINNAMIC ACID
• NSC 203072
• 3-(4-NITROPHENYL)-2,3-DIBROMOPROPIONIC ACID
• γ-(p-Nitrophenyl)-α,β-dibroMopropionic Acid

3-(4-Nitrophenyl)-2,3-dibromopropionic acid

CAS: 35447-78-0

• Formula: C₉H₇Br₂NO₄
• Color and Shape: Solid
• Molecular weight: 352.9642