CAS 3545-78-6
:N-Hydroxyglycine
Description:
N-Hydroxyglycine is an organic compound characterized by its hydroxylamine functional group attached to glycine, making it a derivative of the simplest amino acid. It appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of both amino and hydroxyl groups. This compound is known for its role in various biochemical processes, including its potential as a reducing agent and its involvement in the synthesis of other organic compounds. N-Hydroxyglycine can act as a chelating agent, binding metal ions, which may have implications in both biological systems and industrial applications. Additionally, it has been studied for its potential therapeutic effects, particularly in the context of metabolic disorders. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, N-Hydroxyglycine is a versatile compound with significant relevance in both chemistry and biochemistry.
Formula:C2H5NO3
InChI:InChI=1/C2H5NO3/c4-2(5)1-3-6/h3,6H,1H2,(H,4,5)
InChI key:InChIKey=NPWGWQRXHVJJRD-UHFFFAOYSA-N
SMILES:C(C(O)=O)NO
Synonyms:- (Hydroxyamino)acetic acid
- (o-Carboxymethyl)hydroxylamine
- 2-(Hydroxyamino)acetic acid
- NSC 76386
- glycine, N-hydroxy-
- N-Hydroxyglycine
- N-Hydroxyglycine
- NPWGWQRXHVJJRD-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Hydroxyamino)acetic Acid
CAS:Controlled Product<p>Applications 2-(Hydroxyamino)acetic Acid is a novel lactase inhibitor.<br>References Hattori, M., et al.: J. Insect Physiol., 51, 1359 (2005); Murao, S., et al.: Biosci. Biotech. Biochem., 56, 987 (1992)<br></p>Formula:C2H5NO3Color and Shape:NeatMolecular weight:91.07
