CAS 35450-86-3
:Lutonarin
Description:
Lutonarin, with the CAS number 35450-86-3, is a naturally occurring flavonoid compound primarily found in various plant species. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Lutonarin exhibits a yellow to orange coloration, typical of many flavonoids, and is soluble in organic solvents but has limited solubility in water. This compound is known for its potential health benefits, including anti-inflammatory and antimicrobial activities, making it of interest in both nutritional and pharmaceutical research. Additionally, lutonarin may play a role in plant defense mechanisms against pathogens and environmental stressors. Its presence in certain foods and herbal remedies suggests potential applications in dietary supplements and functional foods. As with many flavonoids, further studies are needed to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C27H30O16
InChI:InChI=1S/C27H30O16/c28-6-15-19(33)22(36)24(38)26(41-15)18-14(42-27-25(39)23(37)20(34)16(7-29)43-27)5-13-17(21(18)35)11(32)4-12(40-13)8-1-2-9(30)10(31)3-8/h1-5,15-16,19-20,22-31,33-39H,6-7H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1
InChI key:InChIKey=OQKYVRDRDIXQMK-KETMJRJWSA-N
SMILES:O(C1=C(C(O)=C2C(=C1)OC(=CC2=O)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-6-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one
- 6-C-Glucosyl-7-O-glucosylluteolin
- Lutonarin
- Isoorientin 7-O-glucoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-5-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-6-β-D-glucopyranosyl-7-(β-D-glucopyranosyloxy)-5-hydroxy-
CAS:Formula:C27H30O16Purity:YellowColor and Shape:SolidMolecular weight:610.5175Lutonarin
CAS:Lutonarin (Isoorientin 7-O-glucoside) is a natural product found in aerial part of Silene jeniseensis.Formula:C27H30O16Purity:98%Color and Shape:SolidMolecular weight:610.52Lutonarin
CAS:Lutonarin is a naturally occurring compound in the plant Pueraria lobata. It has been shown to have anti-cancer properties and can be used as an alternative to radiation therapy for cancer treatment. Lutonarin is a membrane-hyperpolarizing agent that is able to pass through the cell membrane, leading to membrane hyperpolarization. Lutonarin also inhibits the production of gamma-aminobutyric acid (GABA), which leads to increased cell proliferation and inhibition of root formation. Lutonarin has been found to inhibit enzyme activities, such as glucose monitoring and protocatechuic acid, phenolic acid, and crystalline cellulose degradation. This leads to reduced glucose levels in blood plasma and reduced degradation of polysaccharides in roots.Formula:C27H30O16Purity:Min. 95%Molecular weight:610.5 g/mol


