CAS 35453-19-1: 5-Amino-2,4,6-triiodo-1,3-benzenedicarboxylic acid
Description:5-Amino-2,4,6-triiodo-1,3-benzenedicarboxylic acid, with the CAS number 35453-19-1, is a chemical compound characterized by its aromatic structure and the presence of multiple iodine substituents. This compound features two carboxylic acid groups (-COOH) and an amino group (-NH2) attached to a benzene ring, which contributes to its acidic and basic properties. The presence of three iodine atoms significantly enhances its molecular weight and alters its reactivity, making it a compound of interest in various fields, including medicinal chemistry and materials science. The iodine substituents can influence the compound's solubility, stability, and potential biological activity. Additionally, the amino group can participate in hydrogen bonding and other interactions, which may affect the compound's behavior in different environments. Overall, this compound's unique structure and functional groups make it a valuable subject for research, particularly in the development of imaging agents or therapeutic applications.
Formula:C8H4I3NO4
InChI:InChI=1S/C8H4I3NO4/c9-3-1(7(13)14)4(10)6(12)5(11)2(3)8(15)16/h12H2,(H,13,14)(H,15,16)
InChI key:InChIKey=JEZJSNULLBSYHV-UHFFFAOYSA-N
SMILES:O=C(O)C1=C(I)C(N)=C(I)C(C(=O)O)=C1I
- Synonyms:
- 1,3-Benzenedicarboxylic acid, 5-amino-2,4,6-triiodo-
- 2,4,6-Triiodo-5-aminoisophthalic acid
- 5-Amino-2,4,6-Triiodobenzene-1,3-Dicarboxylic Acid
- 5-Amino-2,4,6-Triod-Isophthalic Acid
- 5-Amino-2,4,6-triiodo-1,3-benzenedicarboxylic acid
- 5-Amino-2,4,6-triiodobenzene-1,3-dioic acid
- 5-Amino-2,4,6-triiodoisophthalic acid
- 5-Atipa
- Aminoiodoisophthalicacid
- Isophthalic acid, 5-amino-2,4,6-triiodo-
- See more synonyms
