CAS 354539-34-7

4-amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6H)-one

Description:

4-amino-7,7-dimethyl-7,8-dihydroquinazolin-5(6H)-one is a heterocyclic organic compound characterized by its quinazoline structure, which features a fused bicyclic system containing both benzene and pyrimidine rings. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents. The presence of an amino group and a carbonyl group in its structure contributes to its potential reactivity and biological activity. It may serve as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound's molecular formula reflects its composition of carbon, hydrogen, nitrogen, and oxygen, which influences its physical and chemical properties, such as melting point and stability. Additionally, its CAS number, 354539-34-7, allows for easy identification and reference in chemical databases. Overall, this compound's unique structure and functional groups make it of interest in both research and application in the field of organic chemistry.

Formula: C₁₀H₁₃N₃O

InChI: InChI=1/C10H13N3O/c1-10(2)3-6-8(7(14)4-10)9(11)13-5-12-6/h5H,3-4H2,1-2H3,(H2,11,12,13)

SMILES: CC1(C)Cc2c(C(=O)C1)c(=N)[nH]cn2

4-amino-7,7-dimethyl-7,8-dihydro-5(6H)-quinazolinone

CAS: 354539-34-7

Formula: C₁₀H₁₃N₃O

Purity: 95.0%

Molecular weight: 191.234

Ref: 10-F314815