CAS 35458-34-5

3-Chloro-4-hydroxy-5-methylbenzoic acid

Description:

3-Chloro-4-hydroxy-5-methylbenzoic acid, with the CAS number 35458-34-5, is an aromatic carboxylic acid characterized by the presence of a chloro group, a hydroxyl group, and a methyl group on a benzoic acid framework. This compound typically appears as a solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The chloro substituent enhances its reactivity, making it useful in various chemical syntheses and applications. The hydroxyl group contributes to its acidity and potential for hydrogen bonding, which can influence its solubility and reactivity in different environments. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic reactions. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₇ClO₃

InChI: InChI=1S/C8H7ClO3/c1-4-2-5(8(11)12)3-6(9)7(4)10/h2-3,10H,1H3,(H,11,12)

InChI key: InChIKey=VNYDGBJJSKBZKW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(C)=C(O)C(Cl)=C1

Synonyms:

• Benzoic acid, 3-chloro-4-hydroxy-5-methyl-
• 3-Chloro-4-hydroxy-5-methylbenzoic acid

3-Chloro-4-hydroxy-5-methylbenzoic acid

CAS: 35458-34-5

3-Chloro-4-hydroxy-5-methylbenzoic acid

Purity: 98%

Molecular weight: 186.59g/mol

Ref: 54-OR78194

3-Chloro-4-hydroxy-5-methylbenzoic acid

CAS: 35458-34-5

Purity: 98%

Molecular weight: 186.5899963

Ref: 10-F786881