CAS 35461-98-4
:4-furan-2-ylbenzoic acid
Description:
4-Furan-2-ylbenzoic acid, also known by its CAS number 35461-98-4, is an organic compound characterized by the presence of both a furan ring and a benzoic acid moiety. The furan ring, a five-membered aromatic heterocycle containing one oxygen atom, contributes to the compound's unique reactivity and stability. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic carboxylic acids. Its structure allows for potential hydrogen bonding due to the carboxylic acid functional group, influencing its physical and chemical properties. 4-Furan-2-ylbenzoic acid may also display interesting biological activities, making it a subject of interest in medicinal chemistry and material science. The compound can participate in various chemical reactions, including esterification and amidation, which are useful in synthesizing derivatives for further research and applications. Overall, its unique structural features and functional groups make it a valuable compound in organic synthesis and research.
Formula:C11H8O3
InChI:InChI=1/C11H8O3/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h1-7H,(H,12,13)
SMILES:c1cc(c2ccc(cc2)C(=O)O)oc1
Synonyms:- 4-(2-Furyl)benzoic acid
- Benzoic acid, 4-(2-furanyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Fur-2-yl)benzoic acid
CAS:4-(Fur-2-yl)benzoic acidFormula:C11H8O3Purity:97%Color and Shape: pale yellow powderMolecular weight:188.18g/mol4-Furan-2-yl-benzoic acid
CAS:Formula:C11H8O3Purity:95.0%Color and Shape:SolidMolecular weight:188.1824-(Fur-2-yl)benzoic acid
CAS:4-(Fur-2-yl)benzoic acid is a palladium catalyst for Suzuki coupling reactions with boronic acids. It is also used as a modulator for furyl and benzamide synthesis. 4-(Fur-2-yl)benzoic acid has pharmacokinetic properties that are similar to those of other substituted benzoic acids. This compound is soluble in organic solvents and may be used as the solvent in high yield optimization of pharmacokinetic properties.Formula:C11H8O3Purity:Min. 95%Molecular weight:188.18 g/mol



