CAS 35470-53-2
:methyl (8beta)-6-methylergoline-8-carboxylate
Description:
Methyl (8beta)-6-methylergoline-8-carboxylate, with the CAS number 35470-53-2, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from the ergot alkaloids. This compound features a methyl group at the 6-position and a carboxylate ester at the 8-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its non-polar characteristics. The compound may exhibit biological activity, potentially interacting with various receptors in the central nervous system, although specific pharmacological effects can vary. Its structural modifications suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological conditions. As with many ergoline derivatives, safety and handling precautions are essential due to potential toxicity and regulatory considerations. Further research is necessary to fully elucidate its properties and potential applications in various fields, including pharmacology and biochemistry.
Formula:C17H20N2O2
InChI:InChI=1/C17H20N2O2/c1-19-9-11(17(20)21-2)6-13-12-4-3-5-14-16(12)10(8-18-14)7-15(13)19/h3-5,8,11,13,15,18H,6-7,9H2,1-2H3/t11-,13-,15-/m1/s1
SMILES:CN1C[C@@H](C[C@@H]2c3cccc4c3c(C[C@@H]12)c[nH]4)C(=O)OC
Synonyms:- Ergoline-8-Carboxylic Acid, 6-Methyl-, Methyl Ester, (8Beta)-
- Methyl dihydrolysergate
- Methyl (8beta)-6-methylergoline-8-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Methyl dihydrolysergate
CAS:Methyl dihydrolysergate is a bioactive chemical.Formula:C17H20N2O2Color and Shape:SolidMolecular weight:284.359Dihydrolysergic Acid Methyl Ester
CAS:Controlled ProductApplications Dihydrolysergic Acid Methyl Ester is an intermediate in the synthesis of novel analogs of Cabergoline (C050000), a dopamine D2 receptor agonist.
References Dosa, P. I., et al.: ACS, Med. Chem. Lett., 4, 254 (2013);Formula:C17H20N2O2Color and Shape:NeatMolecular weight:284.35


