CymitQuimica logo

CAS 3548-91-2

:

Cyclopropanamine, 2-phenyl-, sulfate (2:1)

Description:
Cyclopropanamine, 2-phenyl-, sulfate (2:1), with the CAS number 3548-91-2, is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a phenyl group attached to an amine functional group. This compound is typically encountered as a sulfate salt, indicating that it forms a stable ionic compound with sulfate ions. The presence of the cyclopropane moiety contributes to its potential reactivity and steric properties, while the phenyl group can influence its solubility and interaction with biological systems. Cyclopropanamines are of interest in medicinal chemistry due to their potential pharmacological activities, including effects on the central nervous system. The sulfate form may enhance its solubility in aqueous environments, making it more bioavailable. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H11NH2O4S
InChI:InChI=1S/C9H11N.H2O4S/c10-9-6-8(9)7-4-2-1-3-5-7;1-5(2,3)4/h1-5,8-9H,6,10H2;(H2,1,2,3,4)
InChI key:InChIKey=BTHVHSMCHJCPFU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.NC1C(C1)C2=CC=CC=C2
Synonyms:
  • Cyclopropylamine, 2-phenyl-, sulfate (2:1)
  • Cyclopropanamine, 2-phenyl-, sulfate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.