CAS 35480-53-6
:2,6-Bis(2,2,2-trifluoroethoxy)benzoic acid
Description:
2,6-Bis(2,2,2-trifluoroethoxy)benzoic acid is an organic compound characterized by its benzoic acid structure substituted with two trifluoroethoxy groups at the 2 and 6 positions of the aromatic ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the trifluoroethoxy groups enhances the compound's lipophilicity and may influence its solubility in organic solvents. The trifluoromethyl groups are known for their electron-withdrawing properties, which can affect the compound's reactivity and stability. Additionally, the compound may exhibit interesting thermal and chemical stability due to the strong C-F bonds present in the trifluoroethoxy moieties. Its unique structure may also impart specific biological activities or applications in materials science, particularly in the development of fluorinated compounds. Overall, 2,6-Bis(2,2,2-trifluoroethoxy)benzoic acid is notable for its distinctive fluorinated substituents and potential utility in various chemical applications.
Formula:C11H8F6O4
InChI:InChI=1/C11H8F6O4/c12-10(13,14)4-20-6-2-1-3-7(8(6)9(18)19)21-5-11(15,16)17/h1-3H,4-5H2,(H,18,19)
InChI key:InChIKey=XUJRSBBONVZIRL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OCC(F)(F)F)C=CC=C1OCC(F)(F)F
Synonyms:- 2,6-Bis(2,2,2-trifluoroethoxy)benzoic acid
- FXFF1OR BVQ CO1XFFF
- 35480-53-6
- Benzoic acid, 2,6-bis(2,2,2-trifluoroethoxy)-
- Benzoic acid, 2,6-bis(2,2,2-trifluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
