CAS 354815-34-2

6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid

Description:

6-Methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which includes a quinoline framework fused with a cyclopentane ring. This compound features a methyl group and a nitro group, which contribute to its chemical reactivity and potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its interaction with biological systems. The presence of the nitro group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as nitro-containing compounds often exhibit diverse biological activities. Additionally, the stereochemistry of the tetrahydro structure may affect its pharmacokinetics and pharmacodynamics. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₄H₁₄N₂O₄

InChI: InChI=1/C14H14N2O4/c1-7-5-8(16(19)20)6-11-9-3-2-4-10(9)13(14(17)18)15-12(7)11/h2-3,5-6,9-10,13,15H,4H2,1H3,(H,17,18)

SMILES: Cc1cc(cc2C3C=CCC3C(C(=O)O)Nc12)N(=O)=O

6-methyl-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid

CAS: 354815-34-2

Purity: 95.0%

Molecular weight: 274.2760009765625

Ref: 10-F314554