CAS 354816-24-3

8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid

Description:

8-Fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates a fluoro substituent and a carboxylic acid functional group. The presence of the fluoro group typically enhances the compound's biological activity and lipophilicity, potentially influencing its pharmacokinetic properties. The tetrahydro configuration indicates that the compound contains a saturated ring system, which may contribute to its stability and reactivity. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural complexity suggests potential for diverse applications, including in the fields of drug discovery and development. Additionally, the CAS number 354816-24-3 provides a unique identifier for this compound, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound suggest it may possess significant biological activity, warranting further investigation into its potential therapeutic uses.

Formula: C₁₃H₁₂FNO₂

InChI: InChI=1/C13H12FNO2/c14-7-4-5-11-10(6-7)8-2-1-3-9(8)12(15-11)13(16)17/h1-2,4-6,8-9,12,15H,3H2,(H,16,17)

SMILES: C1=CC2C(C1)C(C(=O)O)Nc1ccc(cc21)F

8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid

CAS: 354816-24-3

Purity: 95.0%

Molecular weight: 233.24200439453125

Ref: 10-F314555