CymitQuimica logo

CAS 3549-17-5

:

N-benzyl-2-methoxy-2-[3-(trifluoromethyl)phenyl]ethanamine

Description:
N-benzyl-2-methoxy-2-[3-(trifluoromethyl)phenyl]ethanamine, with the CAS number 3549-17-5, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a benzyl group and a methoxy group attached to a central ethylamine structure, along with a trifluoromethyl-substituted phenyl moiety. The presence of the trifluoromethyl group enhances the lipophilicity and potentially the biological activity of the compound. It is typically characterized by its molecular structure, which contributes to its pharmacological properties. The compound may exhibit various interactions with biological systems, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, N-benzyl-2-methoxy-2-[3-(trifluoromethyl)phenyl]ethanamine represents a complex structure with potential applications in research and pharmaceuticals.
Formula:C17H18F3NO
InChI:InChI=1/C17H18F3NO/c1-22-16(12-21-11-13-6-3-2-4-7-13)14-8-5-9-15(10-14)17(18,19)20/h2-10,16,21H,11-12H2,1H3
SMILES:COC(CNCc1ccccc1)c1cccc(c1)C(F)(F)F
Synonyms:
  • L-N-Benzyl-beta-methoxy-3-trifluoromethylphenethylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.