CAS 355-02-2: Perfluoro(methylcyclohexane)
Description:Perfluoro(methylcyclohexane) is a perfluorinated compound characterized by the presence of a methylcyclohexane structure fully substituted with fluorine atoms. This compound is notable for its high thermal and chemical stability, which is a common trait among perfluorinated substances. It exhibits low surface tension and high hydrophobicity, making it useful in various applications, including as a solvent and in specialty chemical formulations. The presence of fluorine atoms imparts unique properties, such as low reactivity and resistance to degradation, which can be advantageous in industrial processes. Additionally, perfluoro(methylcyclohexane) is non-flammable and has a low vapor pressure, contributing to its safety profile in handling. However, like many perfluorinated compounds, it may raise environmental concerns due to its persistence and potential bioaccumulation. Overall, perfluoro(methylcyclohexane) is a specialized chemical with distinct properties that make it valuable in specific applications while also necessitating careful consideration regarding its environmental impact.
Formula:C7F14
InChI:InChI=1S/C7F14/c8-1(7(19,20)21)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12
InChI key:InChIKey=QIROQPWSJUXOJC-UHFFFAOYSA-N
SMILES:FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
- Synonyms:
- (Trifluoromethyl)undecafluorocyclohexane
- 1,1,2,2,3,3,4,4,5,5,6-Undecafluoro-6-(trifluoromethyl)cyclohexane
- Cyclohexane, 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(trifluoromethyl)-
- Cyclohexane, undecafluoro(trifluoromethyl)-
- Flutec PC 2
- Flutec PP 2
- Khladon 350
- NSC 4779
- Undecafluoro(Trifluoromethyl)Cyclohexane
- Perfluoro(methylcyclohexane)
- See more synonyms
